C40H26N8O2 — CID 102598066
2-[2-[2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]ethoxy]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 102598066) has the molecular formula C40H26N8O2 and a molecular weight of 650.70 g/mol. Its IUPAC name is 2-[2-[2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]ethoxy]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[2-[2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]ethoxy]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 102598066 |
| Molecular Formula | C40H26N8O2 |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 2-[2-[2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenoxy]ethoxy]phenyl]-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c(OCCOc2ccccc2-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1 |
| InChI | InChI=1S/C40H26N8O2/c1-3-15-29(23(9-1)39-45-35-25-11-5-17-41-31(25)32-26(36(35)46-39)12-6-18-42-32)49-21-22-50-30-16-4-2-10-24(30)40-47-37-27-13-7-19-43-33(27)34-28(38(37)48-40)14-8-20-44-34/h1-20H,21-22H2,(H,45,46)(H,47,48) |
| InChIKey | ZMERYHREDIKOQD-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|