C15H23NO2S — CID 102598447
(4-methylphenyl)sulfanylmethyl N,N-di(propan-2-yl)carbamate (PubChem CID 102598447) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is (4-methylphenyl)sulfanylmethyl N,N-di(propan-2-yl)carbamate.
| Compound Name | (4-methylphenyl)sulfanylmethyl N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 102598447 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (4-methylphenyl)sulfanylmethyl N,N-di(propan-2-yl)carbamate |
| SMILES | Cc1ccc(SCOC(=O)N(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-11(2)16(12(3)4)15(17)18-10-19-14-8-6-13(5)7-9-14/h6-9,11-12H,10H2,1-5H3 |
| InChIKey | GWFOGFSSAOVHCP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|