C21H12F3NO3 — CID 102598823
1,1-diphenyl-3-(2,3,4-trifluoro-6-nitrophenyl)prop-2-yn-1-ol (PubChem CID 102598823) has the molecular formula C21H12F3NO3 and a molecular weight of 383.33 g/mol. Its IUPAC name is 1,1-diphenyl-3-(2,3,4-trifluoro-6-nitrophenyl)prop-2-yn-1-ol.
| Compound Name | 1,1-diphenyl-3-(2,3,4-trifluoro-6-nitrophenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 102598823 |
| Molecular Formula | C21H12F3NO3 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1,1-diphenyl-3-(2,3,4-trifluoro-6-nitrophenyl)prop-2-yn-1-ol |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(F)c1C#CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H12F3NO3/c22-17-13-18(25(27)28)16(19(23)20(17)24)11-12-21(26,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,13,26H |
| InChIKey | GKKWDWZCURILJD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|