C29H12F16 — CID 102598930
6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-13-(trifluoromethyl)pentacene (PubChem CID 102598930) has the molecular formula C29H12F16 and a molecular weight of 664.38 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-13-(trifluoromethyl)pentacene.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-13-(trifluoromethyl)pentacene |
|---|---|
| PubChem CID | 102598930 |
| Molecular Formula | C29H12F16 |
| Molecular Weight | 664.38 g/mol |
| Exact Mass | 664.07 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-13-(trifluoromethyl)pentacene |
| SMILES | FC(F)(F)c1c2cc3ccccc3cc2c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C29H12F16/c30-23(31,25(35,36)26(37,38)27(39,40)28(41,42)29(43,44)45)21-17-9-13-5-1-3-7-15(13)11-19(17)22(24(32,33)34)20-12-16-8-4-2-6-14(16)10-18(20)21/h1-12H |
| InChIKey | NBRTYWFYEHASGY-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.38 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|