C23H21NO4 — CID 102599062
(2S,3R)-3-[(2S,4E)-2-methyl-4-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)-4-phenylbutyl]oxirane-2-carbaldehyde (PubChem CID 102599062) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2S,3R)-3-[(2S,4E)-2-methyl-4-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)-4-phenylbutyl]oxirane-2-carbaldehyde.
| Compound Name | (2S,3R)-3-[(2S,4E)-2-methyl-4-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)-4-phenylbutyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 102599062 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (2S,3R)-3-[(2S,4E)-2-methyl-4-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)-4-phenylbutyl]oxirane-2-carbaldehyde |
| SMILES | C[C@@H](C/C(=C1\N=C(c2ccccc2)OC1=O)c1ccccc1)C[C@H]1O[C@@H]1C=O |
| InChI | InChI=1S/C23H21NO4/c1-15(13-19-20(14-25)27-19)12-18(16-8-4-2-5-9-16)21-23(26)28-22(24-21)17-10-6-3-7-11-17/h2-11,14-15,19-20H,12-13H2,1H3/b21-18+/t15-,19+,20+/m0/s1 |
| InChIKey | JCJZQXAYZAMCLQ-NGBFUPLGSA-N |
| XLogP | 3.78 |
| TPSA | 68.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|