C22H47NSi7 — CID 102599168
N-(2,6-dimethylphenyl)-1,2,2,3-tetrakis(trimethylsilyl)-1,2,3-trisilabicyclo[1.1.1]pentan-4-imine (PubChem CID 102599168) has the molecular formula C22H47NSi7 and a molecular weight of 522.23 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1,2,2,3-tetrakis(trimethylsilyl)-1,2,3-trisilabicyclo[1.1.1]pentan-4-imine.
| Compound Name | N-(2,6-dimethylphenyl)-1,2,2,3-tetrakis(trimethylsilyl)-1,2,3-trisilabicyclo[1.1.1]pentan-4-imine |
|---|---|
| PubChem CID | 102599168 |
| Molecular Formula | C22H47NSi7 |
| Molecular Weight | 522.23 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1,2,2,3-tetrakis(trimethylsilyl)-1,2,3-trisilabicyclo[1.1.1]pentan-4-imine |
| SMILES | Cc1cccc(C)c1N=C1[Si]2([Si](C)(C)C)C[Si]1([Si](C)(C)C)[Si]2([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H47NSi7/c1-19-16-15-17-20(2)21(19)23-22-28(24(3,4)5)18-29(22,25(6,7)8)30(28,26(9,10)11)27(12,13)14/h15-17H,18H2,1-14H3 |
| InChIKey | CAPIENITGYSQSF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.23 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|