About CID 102599649
CID 102599649 (PubChem CID 102599649) has the molecular formula C19H28ClN2O2
and a molecular weight of 351.90 g/mol.
Molecular Properties
| Compound Name | CID 102599649 |
| PubChem CID | 102599649 |
| Molecular Formula | C19H28ClN2O2 |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | — |
| SMILES | COC/C=C(\NC1CC(C)(C)N([O])C(C)(C)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H28ClN2O2/c1-18(2)12-16(13-19(3,4)22(18)23)21-17(10-11-24-5)14-6-8-15(20)9-7-14/h6-10,16,21H,11-13H2,1-5H3/b17-10- |
| InChIKey | WFPWSHJEBSTCGL-YVLHZVERSA-N |
| XLogP | 4.28 |
| TPSA | 44.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 102599649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102599649?
The IUPAC name of CID 102599649 (CID 102599649) is not available.
What is the SMILES notation for CID 102599649?
The canonical SMILES for CID 102599649 is COC/C=C(\NC1CC(C)(C)N([O])C(C)(C)C1)c1ccc(Cl)cc1.
What is the InChIKey of CID 102599649?
The InChIKey is WFPWSHJEBSTCGL-YVLHZVERSA-N. The full InChI is InChI=1S/C19H28ClN2O2/c1-18(2)12-16(13-19(3,4)22(18)23)21-17(10-11-24-5)14-6-8-15(20)9-7-14/h6-10,16,21H,11-13H2,1-5H3/b17-10-.
What are the key properties of CID 102599649?
CID 102599649 has a molecular weight of 351.90 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102599649 is sourced from PubChem (CID 102599649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).