C17H27FO3S — CID 102600139
(2R,3S)-3-fluoro-2-octylsulfonyl-3-phenylpropan-1-ol (PubChem CID 102600139) has the molecular formula C17H27FO3S and a molecular weight of 330.46 g/mol. Its IUPAC name is (2R,3S)-3-fluoro-2-octylsulfonyl-3-phenylpropan-1-ol.
| Compound Name | (2R,3S)-3-fluoro-2-octylsulfonyl-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 102600139 |
| Molecular Formula | C17H27FO3S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2R,3S)-3-fluoro-2-octylsulfonyl-3-phenylpropan-1-ol |
| SMILES | CCCCCCCCS(=O)(=O)[C@H](CO)[C@@H](F)c1ccccc1 |
| InChI | InChI=1S/C17H27FO3S/c1-2-3-4-5-6-10-13-22(20,21)16(14-19)17(18)15-11-8-7-9-12-15/h7-9,11-12,16-17,19H,2-6,10,13-14H2,1H3/t16-,17+/m1/s1 |
| InChIKey | KXWMSILLXLXBCP-SJORKVTESA-N |
| XLogP | 3.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|