C19H20N2O2 — CID 102600305
2-(10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)ethyl acetate (PubChem CID 102600305) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)ethyl acetate.
| Compound Name | 2-(10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)ethyl acetate |
|---|---|
| PubChem CID | 102600305 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1(C)Cc2ccccc2-c2ccccc2/N=N\1 |
| InChI | InChI=1S/C19H20N2O2/c1-14(22)23-12-11-19(2)13-15-7-3-4-8-16(15)17-9-5-6-10-18(17)20-21-19/h3-10H,11-13H2,1-2H3/b21-20- |
| InChIKey | JMNDCSKNAHCPRJ-MRCUWXFGSA-N |
| XLogP | 4.71 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |