C18H18N2O2 — CID 102600310
(10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)methyl acetate (PubChem CID 102600310) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)methyl acetate.
| Compound Name | (10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)methyl acetate |
|---|---|
| PubChem CID | 102600310 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,8,12,14-heptaen-10-yl)methyl acetate |
| SMILES | CC(=O)OCC1(C)Cc2ccccc2-c2ccccc2/N=N\1 |
| InChI | InChI=1S/C18H18N2O2/c1-13(21)22-12-18(2)11-14-7-3-4-8-15(14)16-9-5-6-10-17(16)19-20-18/h3-10H,11-12H2,1-2H3/b20-19- |
| InChIKey | BKXWSSRLMJDGPX-VXPUYCOJSA-N |
| XLogP | 4.32 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |