C14H18Cl3NO — CID 102600661
(6S)-2-tert-butyl-4,4,6-trichloro-10-methyl-2-azaspiro[4.5]deca-7,9-dien-3-one (PubChem CID 102600661) has the molecular formula C14H18Cl3NO and a molecular weight of 322.66 g/mol. Its IUPAC name is (6S)-2-tert-butyl-4,4,6-trichloro-10-methyl-2-azaspiro[4.5]deca-7,9-dien-3-one.
| Compound Name | (6S)-2-tert-butyl-4,4,6-trichloro-10-methyl-2-azaspiro[4.5]deca-7,9-dien-3-one |
|---|---|
| PubChem CID | 102600661 |
| Molecular Formula | C14H18Cl3NO |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (6S)-2-tert-butyl-4,4,6-trichloro-10-methyl-2-azaspiro[4.5]deca-7,9-dien-3-one |
| SMILES | CC1=CC=C[C@H](Cl)C12CN(C(C)(C)C)C(=O)C2(Cl)Cl |
| InChI | InChI=1S/C14H18Cl3NO/c1-9-6-5-7-10(15)13(9)8-18(12(2,3)4)11(19)14(13,16)17/h5-7,10H,8H2,1-4H3/t10-,13?/m0/s1 |
| InChIKey | DNZQLWOEKNMNPW-NKUHCKNESA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|