About -(N,N-Dimethylamino)ethylferrocene
-(N,N-Dimethylamino)ethylferrocene (PubChem CID 102600828) has the molecular formula C14H19FeN
and a molecular weight of 257.16 g/mol.
Molecular Properties
| Compound Name | -(N,N-Dimethylamino)ethylferrocene |
| PubChem CID | 102600828 |
| Molecular Formula | C14H19FeN |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | — |
| SMILES | CC(C1=CC=C[CH]1)N(C)C.[CH]1C=CC=C1.[Fe] |
| InChI | InChI=1S/C9H14N.C5H5.Fe/c1-8(10(2)3)9-6-4-5-7-9;1-2-4-5-3-1;/h4-8H,1-3H3;1-5H; |
| InChIKey | ISOLNZQTVMCEOI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze -(N,N-Dimethylamino)ethylferrocene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of -(N,N-Dimethylamino)ethylferrocene?
The IUPAC name of -(N,N-Dimethylamino)ethylferrocene (CID 102600828) is not available.
What is the SMILES notation for -(N,N-Dimethylamino)ethylferrocene?
The canonical SMILES for -(N,N-Dimethylamino)ethylferrocene is CC(C1=CC=C[CH]1)N(C)C.[CH]1C=CC=C1.[Fe].
What is the InChIKey of -(N,N-Dimethylamino)ethylferrocene?
The InChIKey is ISOLNZQTVMCEOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N.C5H5.Fe/c1-8(10(2)3)9-6-4-5-7-9;1-2-4-5-3-1;/h4-8H,1-3H3;1-5H;.
What are the key properties of -(N,N-Dimethylamino)ethylferrocene?
-(N,N-Dimethylamino)ethylferrocene has a molecular weight of 257.16 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for -(N,N-Dimethylamino)ethylferrocene is sourced from PubChem (CID 102600828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).