About 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron
2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron (PubChem CID 102601007) has the molecular formula C16H16FeN2O4
and a molecular weight of 356.16 g/mol. Its IUPAC name is 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron.
Molecular Properties
| Compound Name | 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron |
| PubChem CID | 102601007 |
| Molecular Formula | C16H16FeN2O4 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron |
| SMILES | Oc1ccc(O)c(/N=C/CC/C=N/c2cc(O)ccc2O)c1.[Fe] |
| InChI | InChI=1S/C16H16N2O4.Fe/c19-11-3-5-15(21)13(9-11)17-7-1-2-8-18-14-10-12(20)4-6-16(14)22;/h3-10,19-22H,1-2H2;/b17-7+,18-8+; |
| InChIKey | BMPBVCNMDGZKQB-YNZVUPBFSA-N |
| XLogP | 3.39 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron?
The IUPAC name of 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron (CID 102601007) is 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron.
What is the SMILES notation for 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron?
The canonical SMILES for 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron is Oc1ccc(O)c(/N=C/CC/C=N/c2cc(O)ccc2O)c1.[Fe].
What is the InChIKey of 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron?
The InChIKey is BMPBVCNMDGZKQB-YNZVUPBFSA-N. The full InChI is InChI=1S/C16H16N2O4.Fe/c19-11-3-5-15(21)13(9-11)17-7-1-2-8-18-14-10-12(20)4-6-16(14)22;/h3-10,19-22H,1-2H2;/b17-7+,18-8+;.
What are the key properties of 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron?
2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron has a molecular weight of 356.16 g/mol, XLogP of 3.39, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dihydroxyphenyl)iminobutylideneamino]benzene-1,4-diol;iron is sourced from PubChem (CID 102601007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).