C9H12 — CID 102601121
1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene (PubChem CID 102601121) has the molecular formula C9H12 and a molecular weight of 132.27 g/mol. Its IUPAC name is 1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene.
| Compound Name | 1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene |
|---|---|
| PubChem CID | 102601121 |
| Molecular Formula | C9H12 |
| Molecular Weight | 132.27 g/mol |
| Exact Mass | 132.17 |
| IUPAC Name | 1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene |
| SMILES | [2H]c1c([2H])c(C([2H])([2H])[2H])c(C([2H])([2H])[2H])c([2H])c1C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3/i1D3,2D3,3D3,4D,5D,6D |
| InChIKey | GWHJZXXIDMPWGX-ZPMNDIOMSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |