About potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate
potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate (PubChem CID 102601439) has the molecular formula C7H9KO6S
and a molecular weight of 260.31 g/mol. Its IUPAC name is potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate.
Molecular Properties
| Compound Name | potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate |
| PubChem CID | 102601439 |
| Molecular Formula | C7H9KO6S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate |
| SMILES | COc1cc(S(=O)(=O)[O-])ccc1O.O.[K+] |
| InChI | InChI=1S/C7H8O5S.K.H2O/c1-12-7-4-5(13(9,10)11)2-3-6(7)8;;/h2-4,8H,1H3,(H,9,10,11);;1H2/q;+1;/p-1 |
| InChIKey | UZXRQGSKGNYWCP-UHFFFAOYSA-M |
| XLogP | -3.52 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate?
The IUPAC name of potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate (CID 102601439) is potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate.
What is the SMILES notation for potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate?
The canonical SMILES for potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate is COc1cc(S(=O)(=O)[O-])ccc1O.O.[K+].
What is the InChIKey of potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate?
The InChIKey is UZXRQGSKGNYWCP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O5S.K.H2O/c1-12-7-4-5(13(9,10)11)2-3-6(7)8;;/h2-4,8H,1H3,(H,9,10,11);;1H2/q;+1;/p-1.
What are the key properties of potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate?
potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate has a molecular weight of 260.31 g/mol, XLogP of -3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-hydroxy-3-methoxybenzenesulfonate;hydrate is sourced from PubChem (CID 102601439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).