About Osmocene
Osmocene (PubChem CID 102601604) has the molecular formula C10H10Os
and a molecular weight of 320.42 g/mol.
Molecular Properties
| Compound Name | Osmocene |
| PubChem CID | 102601604 |
| Molecular Formula | C10H10Os |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Os] |
| InChI | InChI=1S/2C5H5.Os/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | RBPKLTFNJHKDRH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Osmocene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Osmocene?
The IUPAC name of Osmocene (CID 102601604) is not available.
What is the SMILES notation for Osmocene?
The canonical SMILES for Osmocene is [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Os].
What is the InChIKey of Osmocene?
The InChIKey is RBPKLTFNJHKDRH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Os/c2*1-2-4-5-3-1;/h2*1-5H;.
What are the key properties of Osmocene?
Osmocene has a molecular weight of 320.42 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Osmocene is sourced from PubChem (CID 102601604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).