About copper;bis(2-methylprop-2-enoic acid)
copper;bis(2-methylprop-2-enoic acid) (PubChem CID 102601747) has the molecular formula C8H12CuO4
and a molecular weight of 235.73 g/mol. Its IUPAC name is copper;bis(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | copper;bis(2-methylprop-2-enoic acid) |
| PubChem CID | 102601747 |
| Molecular Formula | C8H12CuO4 |
| Molecular Weight | 235.73 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | copper;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.[Cu] |
| InChI | InChI=1S/2C4H6O2.Cu/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6); |
| InChIKey | XTTBGOTUDWALQL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.73 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(2-methylprop-2-enoic acid)?
The IUPAC name of copper;bis(2-methylprop-2-enoic acid) (CID 102601747) is copper;bis(2-methylprop-2-enoic acid).
What is the SMILES notation for copper;bis(2-methylprop-2-enoic acid)?
The canonical SMILES for copper;bis(2-methylprop-2-enoic acid) is C=C(C)C(=O)O.C=C(C)C(=O)O.[Cu].
What is the InChIKey of copper;bis(2-methylprop-2-enoic acid)?
The InChIKey is XTTBGOTUDWALQL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O2.Cu/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);.
What are the key properties of copper;bis(2-methylprop-2-enoic acid)?
copper;bis(2-methylprop-2-enoic acid) has a molecular weight of 235.73 g/mol, XLogP of 1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(2-methylprop-2-enoic acid) is sourced from PubChem (CID 102601747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).