About 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide
2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide (PubChem CID 102601846) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide |
| PubChem CID | 102601846 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide |
| SMILES | CCOC1C=C[C@H](OC)[C@@H]1NCC(N)=O |
| InChI | InChI=1S/C10H18N2O3/c1-3-15-8-5-4-7(14-2)10(8)12-6-9(11)13/h4-5,7-8,10,12H,3,6H2,1-2H3,(H2,11,13)/t7-,8?,10-/m0/s1 |
| InChIKey | UNUUDPOTFSTGJW-OFQRNFBNSA-N |
| XLogP | -0.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide?
The IUPAC name of 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide (CID 102601846) is 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide.
What is the SMILES notation for 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide?
The canonical SMILES for 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide is CCOC1C=C[C@H](OC)[C@@H]1NCC(N)=O.
What is the InChIKey of 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide?
The InChIKey is UNUUDPOTFSTGJW-OFQRNFBNSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-3-15-8-5-4-7(14-2)10(8)12-6-9(11)13/h4-5,7-8,10,12H,3,6H2,1-2H3,(H2,11,13)/t7-,8?,10-/m0/s1.
What are the key properties of 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide?
2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide has a molecular weight of 214.26 g/mol, XLogP of -0.58, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,5S)-2-ethoxy-5-methoxycyclopent-3-en-1-yl]amino]acetamide is sourced from PubChem (CID 102601846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).