C23H28N2O4 — CID 102602635
(2S)-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 102602635) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102602635 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C23H28N2O4/c1-15(22(28)29)24-21(27)19(14-16-8-6-5-7-9-16)25-20(26)17-10-12-18(13-11-17)23(2,3)4/h5-13,15,19H,14H2,1-4H3,(H,24,27)(H,25,26)(H,28,29)/t15-,19-/m0/s1 |
| InChIKey | IVNZRDVXXJFTQF-KXBFYZLASA-N |
| XLogP | 2.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |