About aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane
aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 102602974) has the molecular formula C26H38NO2PS2
and a molecular weight of 491.70 g/mol. Its IUPAC name is aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 102602974 |
| Molecular Formula | C26H38NO2PS2 |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | Nc1ccccc1.S=P(S)(OC12CC3CC(CC(C3)C1)C2)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H31O2PS2.C6H7N/c24-23(25,21-19-7-13-1-14(8-19)3-15(2-13)9-19)22-20-10-16-4-17(11-20)6-18(5-16)12-20;7-6-4-2-1-3-5-6/h13-18H,1-12H2,(H,24,25);1-5H,7H2 |
| InChIKey | LSLDHRJNAGNIAR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane?
The IUPAC name of aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane (CID 102602974) is aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane is Nc1ccccc1.S=P(S)(OC12CC3CC(CC(C3)C1)C2)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane?
The InChIKey is LSLDHRJNAGNIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31O2PS2.C6H7N/c24-23(25,21-19-7-13-1-14(8-19)3-15(2-13)9-19)22-20-10-16-4-17(11-20)6-18(5-16)12-20;7-6-4-2-1-3-5-6/h13-18H,1-12H2,(H,24,25);1-5H,7H2.
What are the key properties of aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane?
aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane has a molecular weight of 491.70 g/mol, XLogP of 7.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;bis(1-adamantyloxy)-sulfanyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 102602974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).