About (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine
(2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine (PubChem CID 1026072) has the molecular formula C18H17NO4S2
and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine |
| PubChem CID | 1026072 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCS[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17NO4S2/c20-25(21,11-8-14-4-2-1-3-5-14)19-9-10-24-18(19)15-6-7-16-17(12-15)23-13-22-16/h1-8,11-12,18H,9-10,13H2/b11-8+/t18-/m0/s1 |
| InChIKey | ISJPBFRPPFBUGD-MZEUMTGBSA-N |
| XLogP | 3.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine?
The IUPAC name of (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine (CID 1026072) is (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine.
What is the SMILES notation for (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine?
The canonical SMILES for (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine is O=S(=O)(/C=C/c1ccccc1)N1CCS[C@H]1c1ccc2c(c1)OCO2.
What is the InChIKey of (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine?
The InChIKey is ISJPBFRPPFBUGD-MZEUMTGBSA-N. The full InChI is InChI=1S/C18H17NO4S2/c20-25(21,11-8-14-4-2-1-3-5-14)19-9-10-24-18(19)15-6-7-16-17(12-15)23-13-22-16/h1-8,11-12,18H,9-10,13H2/b11-8+/t18-/m0/s1.
What are the key properties of (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine?
(2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine has a molecular weight of 375.47 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,3-benzodioxol-5-yl)-3-[(E)-2-phenylethenyl]sulfonyl-1,3-thiazolidine is sourced from PubChem (CID 1026072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).