About 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole
4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole (PubChem CID 102607214) has the molecular formula C9H13BrN2O2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole.
Molecular Properties
| Compound Name | 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole |
| PubChem CID | 102607214 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole |
| SMILES | Cc1nn(C)c(COC2COC2)c1Br |
| InChI | InChI=1S/C9H13BrN2O2/c1-6-9(10)8(12(2)11-6)5-14-7-3-13-4-7/h7H,3-5H2,1-2H3 |
| InChIKey | NJYVNRRMJQOGSU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole?
The IUPAC name of 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole (CID 102607214) is 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole.
What is the SMILES notation for 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole?
The canonical SMILES for 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole is Cc1nn(C)c(COC2COC2)c1Br.
What is the InChIKey of 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole?
The InChIKey is NJYVNRRMJQOGSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O2/c1-6-9(10)8(12(2)11-6)5-14-7-3-13-4-7/h7H,3-5H2,1-2H3.
What are the key properties of 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole?
4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole has a molecular weight of 261.12 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,3-dimethyl-5-(oxetan-3-yloxymethyl)pyrazole is sourced from PubChem (CID 102607214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).