C14H27NO4 — CID 102607425
methyl 2-methyl-6-(oxetan-3-yloxy)-2-(propan-2-ylamino)hexanoate (PubChem CID 102607425) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is methyl 2-methyl-6-(oxetan-3-yloxy)-2-(propan-2-ylamino)hexanoate.
| Compound Name | methyl 2-methyl-6-(oxetan-3-yloxy)-2-(propan-2-ylamino)hexanoate |
|---|---|
| PubChem CID | 102607425 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | methyl 2-methyl-6-(oxetan-3-yloxy)-2-(propan-2-ylamino)hexanoate |
| SMILES | COC(=O)C(C)(CCCCOC1COC1)NC(C)C |
| InChI | InChI=1S/C14H27NO4/c1-11(2)15-14(3,13(16)17-4)7-5-6-8-19-12-9-18-10-12/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | JKGTUEOZVDFJNZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|