C10H14N2O3S — CID 102608464
5-methyl-4-(oxetan-3-yloxymethyl)thiophene-2-carbohydrazide (PubChem CID 102608464) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-methyl-4-(oxetan-3-yloxymethyl)thiophene-2-carbohydrazide.
| Compound Name | 5-methyl-4-(oxetan-3-yloxymethyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 102608464 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 5-methyl-4-(oxetan-3-yloxymethyl)thiophene-2-carbohydrazide |
| SMILES | Cc1sc(C(=O)NN)cc1COC1COC1 |
| InChI | InChI=1S/C10H14N2O3S/c1-6-7(3-15-8-4-14-5-8)2-9(16-6)10(13)12-11/h2,8H,3-5,11H2,1H3,(H,12,13) |
| InChIKey | WUUORNGBCUOFQJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|