C11H14N2O5S — CID 102608651
oxetan-3-yl 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 102608651) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is oxetan-3-yl 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | oxetan-3-yl 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 102608651 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | oxetan-3-yl 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OC2COC2)n(C2CC2)c1 |
| InChI | InChI=1S/C11H14N2O5S/c12-19(15,16)9-3-10(13(4-9)7-1-2-7)11(14)18-8-5-17-6-8/h3-4,7-8H,1-2,5-6H2,(H2,12,15,16) |
| InChIKey | JOZTXWTWKPATSL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |