About [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate
[2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate (PubChem CID 1026092) has the molecular formula C19H11N3O8
and a molecular weight of 409.31 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate.
Molecular Properties
| Compound Name | [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate |
| PubChem CID | 1026092 |
| Molecular Formula | C19H11N3O8 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(CN3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)oc(=O)c2c1 |
| InChI | InChI=1S/C19H11N3O8/c1-9(23)29-11-3-5-15-14(7-11)19(26)30-16(20-15)8-21-17(24)12-4-2-10(22(27)28)6-13(12)18(21)25/h2-7H,8H2,1H3 |
| InChIKey | RGGSQGDMHONFHH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 149.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate?
The IUPAC name of [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate (CID 1026092) is [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate.
What is the SMILES notation for [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate?
The canonical SMILES for [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate is CC(=O)Oc1ccc2nc(CN3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)oc(=O)c2c1.
What is the InChIKey of [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate?
The InChIKey is RGGSQGDMHONFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11N3O8/c1-9(23)29-11-3-5-15-14(7-11)19(26)30-16(20-15)8-21-17(24)12-4-2-10(22(27)28)6-13(12)18(21)25/h2-7H,8H2,1H3.
What are the key properties of [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate?
[2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate has a molecular weight of 409.31 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate is sourced from PubChem (CID 1026092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).