C13H22N2O4S2 — CID 102609395
4-N-(2,2,3-trimethylbutyl)benzene-1,4-disulfonamide (PubChem CID 102609395) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-N-(2,2,3-trimethylbutyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(2,2,3-trimethylbutyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 102609395 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-N-(2,2,3-trimethylbutyl)benzene-1,4-disulfonamide |
| SMILES | CC(C)C(C)(C)CNS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-10(2)13(3,4)9-15-21(18,19)12-7-5-11(6-8-12)20(14,16)17/h5-8,10,15H,9H2,1-4H3,(H2,14,16,17) |
| InChIKey | VCBWOWKZIZYMJV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |