C11H8F2N2O2S — CID 102609776
2,4-difluoro-N-[(5-nitrothiophen-2-yl)methyl]aniline (PubChem CID 102609776) has the molecular formula C11H8F2N2O2S and a molecular weight of 270.26 g/mol. Its IUPAC name is 2,4-difluoro-N-[(5-nitrothiophen-2-yl)methyl]aniline.
| Compound Name | 2,4-difluoro-N-[(5-nitrothiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 102609776 |
| Molecular Formula | C11H8F2N2O2S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2,4-difluoro-N-[(5-nitrothiophen-2-yl)methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(CNc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C11H8F2N2O2S/c12-7-1-3-10(9(13)5-7)14-6-8-2-4-11(18-8)15(16)17/h1-5,14H,6H2 |
| InChIKey | QDTYZCZJFKLLER-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|