About N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine (PubChem CID 102610357) has the molecular formula C10H15ClN2OS
and a molecular weight of 246.76 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine.
Molecular Properties
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine |
| PubChem CID | 102610357 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine |
| SMILES | CCOC1CC(NCc2ncc(Cl)s2)C1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-2-14-8-3-7(4-8)12-6-10-13-5-9(11)15-10/h5,7-8,12H,2-4,6H2,1H3 |
| InChIKey | HERYBQUEMQUZMH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine?
The IUPAC name of N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine (CID 102610357) is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine.
What is the SMILES notation for N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine?
The canonical SMILES for N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine is CCOC1CC(NCc2ncc(Cl)s2)C1.
What is the InChIKey of N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine?
The InChIKey is HERYBQUEMQUZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2OS/c1-2-14-8-3-7(4-8)12-6-10-13-5-9(11)15-10/h5,7-8,12H,2-4,6H2,1H3.
What are the key properties of N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine?
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine has a molecular weight of 246.76 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-ethoxycyclobutan-1-amine is sourced from PubChem (CID 102610357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).