About 1-fluorocubane
1-fluorocubane (PubChem CID 10261101) has the molecular formula C8H7F
and a molecular weight of 122.14 g/mol. Its IUPAC name is 1-fluorocubane.
Molecular Properties
| Compound Name | 1-fluorocubane |
| PubChem CID | 10261101 |
| Molecular Formula | C8H7F |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 1-fluorocubane |
| SMILES | FC12C3C4C5C3C1C5C42 |
| InChI | InChI=1S/C8H7F/c9-8-5-2-1-3(5)7(8)4(1)6(2)8/h1-7H |
| InChIKey | DIVWWCLPOLQNDT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluorocubane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorocubane?
The IUPAC name of 1-fluorocubane (CID 10261101) is 1-fluorocubane.
What is the SMILES notation for 1-fluorocubane?
The canonical SMILES for 1-fluorocubane is FC12C3C4C5C3C1C5C42.
What is the InChIKey of 1-fluorocubane?
The InChIKey is DIVWWCLPOLQNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F/c9-8-5-2-1-3(5)7(8)4(1)6(2)8/h1-7H.
What are the key properties of 1-fluorocubane?
1-fluorocubane has a molecular weight of 122.14 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorocubane is sourced from PubChem (CID 10261101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).