C13H17FN2O3 — CID 102611096
N-(3-fluoro-4-methoxyphenyl)-2-(3-methylazetidin-3-yl)oxyacetamide (PubChem CID 102611096) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-2-(3-methylazetidin-3-yl)oxyacetamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-2-(3-methylazetidin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 102611096 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-2-(3-methylazetidin-3-yl)oxyacetamide |
| SMILES | COc1ccc(NC(=O)COC2(C)CNC2)cc1F |
| InChI | InChI=1S/C13H17FN2O3/c1-13(7-15-8-13)19-6-12(17)16-9-3-4-11(18-2)10(14)5-9/h3-5,15H,6-8H2,1-2H3,(H,16,17) |
| InChIKey | UVRYKDJXWCJXLX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |