C10H20N2O3 — CID 102611126
N-(2-ethoxyethyl)-2-(3-methylazetidin-3-yl)oxyacetamide (PubChem CID 102611126) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-(3-methylazetidin-3-yl)oxyacetamide.
| Compound Name | N-(2-ethoxyethyl)-2-(3-methylazetidin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 102611126 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-(2-ethoxyethyl)-2-(3-methylazetidin-3-yl)oxyacetamide |
| SMILES | CCOCCNC(=O)COC1(C)CNC1 |
| InChI | InChI=1S/C10H20N2O3/c1-3-14-5-4-12-9(13)6-15-10(2)7-11-8-10/h11H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | JYHNLWZVMGBTEH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|