About 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile
6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile (PubChem CID 10261151) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile |
| PubChem CID | 10261151 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile |
| SMILES | N#CC1C(=O)CCN=C1N |
| InChI | InChI=1S/C6H7N3O/c7-3-4-5(10)1-2-9-6(4)8/h4H,1-2H2,(H2,8,9) |
| InChIKey | YUZVYZRPYJIVPS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile?
The IUPAC name of 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile (CID 10261151) is 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile.
What is the SMILES notation for 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile?
The canonical SMILES for 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile is N#CC1C(=O)CCN=C1N.
What is the InChIKey of 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile?
The InChIKey is YUZVYZRPYJIVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c7-3-4-5(10)1-2-9-6(4)8/h4H,1-2H2,(H2,8,9).
What are the key properties of 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile?
6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile has a molecular weight of 137.14 g/mol, XLogP of -0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-oxo-3,5-dihydro-2H-pyridine-5-carbonitrile is sourced from PubChem (CID 10261151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).