About N-(5-methylhexa-3,4-dienyl)propan-2-imine
N-(5-methylhexa-3,4-dienyl)propan-2-imine (PubChem CID 10261266) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-(5-methylhexa-3,4-dienyl)propan-2-imine.
Molecular Properties
| Compound Name | N-(5-methylhexa-3,4-dienyl)propan-2-imine |
| PubChem CID | 10261266 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-(5-methylhexa-3,4-dienyl)propan-2-imine |
| SMILES | CC(C)=C=CCCN=C(C)C |
| InChI | InChI=1S/C10H17N/c1-9(2)7-5-6-8-11-10(3)4/h5H,6,8H2,1-4H3 |
| InChIKey | OWLOUDUGNDHKKI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methylhexa-3,4-dienyl)propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methylhexa-3,4-dienyl)propan-2-imine?
The IUPAC name of N-(5-methylhexa-3,4-dienyl)propan-2-imine (CID 10261266) is N-(5-methylhexa-3,4-dienyl)propan-2-imine.
What is the SMILES notation for N-(5-methylhexa-3,4-dienyl)propan-2-imine?
The canonical SMILES for N-(5-methylhexa-3,4-dienyl)propan-2-imine is CC(C)=C=CCCN=C(C)C.
What is the InChIKey of N-(5-methylhexa-3,4-dienyl)propan-2-imine?
The InChIKey is OWLOUDUGNDHKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-9(2)7-5-6-8-11-10(3)4/h5H,6,8H2,1-4H3.
What are the key properties of N-(5-methylhexa-3,4-dienyl)propan-2-imine?
N-(5-methylhexa-3,4-dienyl)propan-2-imine has a molecular weight of 151.25 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methylhexa-3,4-dienyl)propan-2-imine is sourced from PubChem (CID 10261266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).