C7H10N2S — CID 10261296
5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol (PubChem CID 10261296) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol.
| Compound Name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol |
|---|---|
| PubChem CID | 10261296 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol |
| SMILES | SC1CCn2ccnc2C1 |
| InChI | InChI=1S/C7H10N2S/c10-6-1-3-9-4-2-8-7(9)5-6/h2,4,6,10H,1,3,5H2 |
| InChIKey | XSZCQYOEDAKQTO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|