About 2-but-3-enylbenzaldehyde
2-but-3-enylbenzaldehyde (PubChem CID 10261375) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-but-3-enylbenzaldehyde.
Molecular Properties
| Compound Name | 2-but-3-enylbenzaldehyde |
| PubChem CID | 10261375 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-but-3-enylbenzaldehyde |
| SMILES | C=CCCc1ccccc1C=O |
| InChI | InChI=1S/C11H12O/c1-2-3-6-10-7-4-5-8-11(10)9-12/h2,4-5,7-9H,1,3,6H2 |
| InChIKey | GOVAFMLHEIZNFQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enylbenzaldehyde?
The IUPAC name of 2-but-3-enylbenzaldehyde (CID 10261375) is 2-but-3-enylbenzaldehyde.
What is the SMILES notation for 2-but-3-enylbenzaldehyde?
The canonical SMILES for 2-but-3-enylbenzaldehyde is C=CCCc1ccccc1C=O.
What is the InChIKey of 2-but-3-enylbenzaldehyde?
The InChIKey is GOVAFMLHEIZNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-2-3-6-10-7-4-5-8-11(10)9-12/h2,4-5,7-9H,1,3,6H2.
What are the key properties of 2-but-3-enylbenzaldehyde?
2-but-3-enylbenzaldehyde has a molecular weight of 160.22 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enylbenzaldehyde is sourced from PubChem (CID 10261375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).