C15H23NO — CID 102613780
(2S)-2-(hex-5-en-2-ylamino)-3-phenylpropan-1-ol (PubChem CID 102613780) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (2S)-2-(hex-5-en-2-ylamino)-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-(hex-5-en-2-ylamino)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 102613780 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2S)-2-(hex-5-en-2-ylamino)-3-phenylpropan-1-ol |
| SMILES | C=CCCC(C)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-3-4-8-13(2)16-15(12-17)11-14-9-6-5-7-10-14/h3,5-7,9-10,13,15-17H,1,4,8,11-12H2,2H3/t13?,15-/m0/s1 |
| InChIKey | AIQVMEQJOVIVHG-WUJWULDRSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|