C10H20O2 — CID 10261564
(4S,5R,6R)-5-hydroxy-4,6-dimethyloctan-3-one (PubChem CID 10261564) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (4S,5R,6R)-5-hydroxy-4,6-dimethyloctan-3-one.
| Compound Name | (4S,5R,6R)-5-hydroxy-4,6-dimethyloctan-3-one |
|---|---|
| PubChem CID | 10261564 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (4S,5R,6R)-5-hydroxy-4,6-dimethyloctan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@H](O)[C@H](C)CC |
| InChI | InChI=1S/C10H20O2/c1-5-7(3)10(12)8(4)9(11)6-2/h7-8,10,12H,5-6H2,1-4H3/t7-,8-,10-/m1/s1 |
| InChIKey | JDLBYTLZSONDPP-NQMVMOMDSA-N |
| XLogP | 2.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |