About 5-methyl-1H-1,6-naphthyridine-2-thione
5-methyl-1H-1,6-naphthyridine-2-thione (PubChem CID 10261617) has the molecular formula C9H8N2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is 5-methyl-1H-1,6-naphthyridine-2-thione.
Molecular Properties
| Compound Name | 5-methyl-1H-1,6-naphthyridine-2-thione |
| PubChem CID | 10261617 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 5-methyl-1H-1,6-naphthyridine-2-thione |
| SMILES | Cc1nccc2[nH]c(=S)ccc12 |
| InChI | InChI=1S/C9H8N2S/c1-6-7-2-3-9(12)11-8(7)4-5-10-6/h2-5H,1H3,(H,11,12) |
| InChIKey | JCPSOAPENKREHO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1H-1,6-naphthyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-1,6-naphthyridine-2-thione?
The IUPAC name of 5-methyl-1H-1,6-naphthyridine-2-thione (CID 10261617) is 5-methyl-1H-1,6-naphthyridine-2-thione.
What is the SMILES notation for 5-methyl-1H-1,6-naphthyridine-2-thione?
The canonical SMILES for 5-methyl-1H-1,6-naphthyridine-2-thione is Cc1nccc2[nH]c(=S)ccc12.
What is the InChIKey of 5-methyl-1H-1,6-naphthyridine-2-thione?
The InChIKey is JCPSOAPENKREHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S/c1-6-7-2-3-9(12)11-8(7)4-5-10-6/h2-5H,1H3,(H,11,12).
What are the key properties of 5-methyl-1H-1,6-naphthyridine-2-thione?
5-methyl-1H-1,6-naphthyridine-2-thione has a molecular weight of 176.24 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-1,6-naphthyridine-2-thione is sourced from PubChem (CID 10261617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).