(Z)-2-(2,2-difluoropropyl)pent-3-enoic acid

C8H12F2O2 — CID 10261642

IUPAC(Z)-2-(2,2-difluoropropyl)pent-3-enoic acid
SMILESC/C=C\C(CC(C)(F)F)C(=O)O
InChIInChI=1S/C8H12F2O2/c1-3-4-6(7(11)12)5-8(2,9)10/h3-4,6H,5H2,1-2H3,(H,11,12)/b4-3-
InChIKeyHJVIPUPWQQQQIR-ARJAWSKDSA-N
MW178.18 g/mol
LogP2.31
Rot. Bonds4

About (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid

(Z)-2-(2,2-difluoropropyl)pent-3-enoic acid (PubChem CID 10261642) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid.

Molecular Properties

Compound Name(Z)-2-(2,2-difluoropropyl)pent-3-enoic acid
PubChem CID10261642
Molecular FormulaC8H12F2O2
Molecular Weight178.18 g/mol
Exact Mass178.08
IUPAC Name(Z)-2-(2,2-difluoropropyl)pent-3-enoic acid
SMILESC/C=C\C(CC(C)(F)F)C(=O)O
InChIInChI=1S/C8H12F2O2/c1-3-4-6(7(11)12)5-8(2,9)10/h3-4,6H,5H2,1-2H3,(H,11,12)/b4-3-
InChIKeyHJVIPUPWQQQQIR-ARJAWSKDSA-N
XLogP2.31
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.18
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid?
The IUPAC name of (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid (CID 10261642) is (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid.
What is the SMILES notation for (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid?
The canonical SMILES for (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid is C/C=C\C(CC(C)(F)F)C(=O)O.
What is the InChIKey of (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid?
The InChIKey is HJVIPUPWQQQQIR-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H12F2O2/c1-3-4-6(7(11)12)5-8(2,9)10/h3-4,6H,5H2,1-2H3,(H,11,12)/b4-3-.
What are the key properties of (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid?
(Z)-2-(2,2-difluoropropyl)pent-3-enoic acid has a molecular weight of 178.18 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,2-difluoropropyl)pent-3-enoic acid is sourced from PubChem (CID 10261642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).