C16H16ClFO3 — CID 102616497
(1S)-1-[4-[(2-chloro-5-fluorophenyl)methoxy]-3-methoxyphenyl]ethanol (PubChem CID 102616497) has the molecular formula C16H16ClFO3 and a molecular weight of 310.75 g/mol. Its IUPAC name is (1S)-1-[4-[(2-chloro-5-fluorophenyl)methoxy]-3-methoxyphenyl]ethanol.
| Compound Name | (1S)-1-[4-[(2-chloro-5-fluorophenyl)methoxy]-3-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 102616497 |
| Molecular Formula | C16H16ClFO3 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (1S)-1-[4-[(2-chloro-5-fluorophenyl)methoxy]-3-methoxyphenyl]ethanol |
| SMILES | COc1cc([C@H](C)O)ccc1OCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C16H16ClFO3/c1-10(19)11-3-6-15(16(8-11)20-2)21-9-12-7-13(18)4-5-14(12)17/h3-8,10,19H,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | HAOWVZNXSADIPZ-JTQLQIEISA-N |
| XLogP | 4.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |