About 7-nitro-2,1-benzothiazole
7-nitro-2,1-benzothiazole (PubChem CID 10261696) has the molecular formula C7H4N2O2S
and a molecular weight of 180.19 g/mol. Its IUPAC name is 7-nitro-2,1-benzothiazole.
Molecular Properties
| Compound Name | 7-nitro-2,1-benzothiazole |
| PubChem CID | 10261696 |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 7-nitro-2,1-benzothiazole |
| SMILES | O=[N+]([O-])c1cccc2csnc12 |
| InChI | InChI=1S/C7H4N2O2S/c10-9(11)6-3-1-2-5-4-12-8-7(5)6/h1-4H |
| InChIKey | IAMBLRQVZCQTNF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-2,1-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-2,1-benzothiazole?
The IUPAC name of 7-nitro-2,1-benzothiazole (CID 10261696) is 7-nitro-2,1-benzothiazole.
What is the SMILES notation for 7-nitro-2,1-benzothiazole?
The canonical SMILES for 7-nitro-2,1-benzothiazole is O=[N+]([O-])c1cccc2csnc12.
What is the InChIKey of 7-nitro-2,1-benzothiazole?
The InChIKey is IAMBLRQVZCQTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2S/c10-9(11)6-3-1-2-5-4-12-8-7(5)6/h1-4H.
What are the key properties of 7-nitro-2,1-benzothiazole?
7-nitro-2,1-benzothiazole has a molecular weight of 180.19 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-2,1-benzothiazole is sourced from PubChem (CID 10261696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).