C15H18ClFN2 — CID 102617084
N-[[1-[(2-chloro-5-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine (PubChem CID 102617084) has the molecular formula C15H18ClFN2 and a molecular weight of 280.77 g/mol. Its IUPAC name is N-[[1-[(2-chloro-5-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(2-chloro-5-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102617084 |
| Molecular Formula | C15H18ClFN2 |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[[1-[(2-chloro-5-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccn1Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C15H18ClFN2/c1-2-7-18-10-14-4-3-8-19(14)11-12-9-13(17)5-6-15(12)16/h3-6,8-9,18H,2,7,10-11H2,1H3 |
| InChIKey | CRTXVALIEHYRLU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|