About 1,4-ditert-butylimidazole
1,4-ditert-butylimidazole (PubChem CID 10261718) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,4-ditert-butylimidazole.
Molecular Properties
| Compound Name | 1,4-ditert-butylimidazole |
| PubChem CID | 10261718 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,4-ditert-butylimidazole |
| SMILES | CC(C)(C)c1cn(C(C)(C)C)cn1 |
| InChI | InChI=1S/C11H20N2/c1-10(2,3)9-7-13(8-12-9)11(4,5)6/h7-8H,1-6H3 |
| InChIKey | GUHVXILIPVKKOT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-ditert-butylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylimidazole?
The IUPAC name of 1,4-ditert-butylimidazole (CID 10261718) is 1,4-ditert-butylimidazole.
What is the SMILES notation for 1,4-ditert-butylimidazole?
The canonical SMILES for 1,4-ditert-butylimidazole is CC(C)(C)c1cn(C(C)(C)C)cn1.
What is the InChIKey of 1,4-ditert-butylimidazole?
The InChIKey is GUHVXILIPVKKOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-10(2,3)9-7-13(8-12-9)11(4,5)6/h7-8H,1-6H3.
What are the key properties of 1,4-ditert-butylimidazole?
1,4-ditert-butylimidazole has a molecular weight of 180.29 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylimidazole is sourced from PubChem (CID 10261718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).