C17H25ClFN — CID 102617496
1-[(2-chloro-5-fluorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine (PubChem CID 102617496) has the molecular formula C17H25ClFN and a molecular weight of 297.85 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102617496 |
| Molecular Formula | C17H25ClFN |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
| SMILES | CC1CCC(C(C)C)C(N)(Cc2cc(F)ccc2Cl)C1 |
| InChI | InChI=1S/C17H25ClFN/c1-11(2)15-6-4-12(3)9-17(15,20)10-13-8-14(19)5-7-16(13)18/h5,7-8,11-12,15H,4,6,9-10,20H2,1-3H3 |
| InChIKey | ZATRLITZZVZQTQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |