C10H15BrN2OS — CID 102618227
5-bromo-3-(1-ethoxycyclohexyl)-1,2,4-thiadiazole (PubChem CID 102618227) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 5-bromo-3-(1-ethoxycyclohexyl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(1-ethoxycyclohexyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618227 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 5-bromo-3-(1-ethoxycyclohexyl)-1,2,4-thiadiazole |
| SMILES | CCOC1(c2nsc(Br)n2)CCCCC1 |
| InChI | InChI=1S/C10H15BrN2OS/c1-2-14-10(6-4-3-5-7-10)8-12-9(11)15-13-8/h2-7H2,1H3 |
| InChIKey | ROCKAUIKTCGOGM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |