C9H8ClF3O — CID 102618230
3-(2-chloro-5-fluorophenyl)-1,1-difluoropropan-2-ol (PubChem CID 102618230) has the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. Its IUPAC name is 3-(2-chloro-5-fluorophenyl)-1,1-difluoropropan-2-ol.
| Compound Name | 3-(2-chloro-5-fluorophenyl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 102618230 |
| Molecular Formula | C9H8ClF3O |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 3-(2-chloro-5-fluorophenyl)-1,1-difluoropropan-2-ol |
| SMILES | OC(Cc1cc(F)ccc1Cl)C(F)F |
| InChI | InChI=1S/C9H8ClF3O/c10-7-2-1-6(11)3-5(7)4-8(14)9(12)13/h1-3,8-9,14H,4H2 |
| InChIKey | LYEHWVGVUOKYEU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |