About 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile
5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile (PubChem CID 10261861) has the molecular formula C9H9N5
and a molecular weight of 187.21 g/mol. Its IUPAC name is 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile |
| PubChem CID | 10261861 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile |
| SMILES | Cc1nc2cc(C#N)c(N)nc2n1C |
| InChI | InChI=1S/C9H9N5/c1-5-12-7-3-6(4-10)8(11)13-9(7)14(5)2/h3H,1-2H3,(H2,11,13) |
| InChIKey | CODPTDGOWAENSC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile?
The IUPAC name of 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile (CID 10261861) is 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile.
What is the SMILES notation for 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile?
The canonical SMILES for 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile is Cc1nc2cc(C#N)c(N)nc2n1C.
What is the InChIKey of 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile?
The InChIKey is CODPTDGOWAENSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5/c1-5-12-7-3-6(4-10)8(11)13-9(7)14(5)2/h3H,1-2H3,(H2,11,13).
What are the key properties of 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile?
5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile has a molecular weight of 187.21 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dimethylimidazo[4,5-b]pyridine-6-carbonitrile is sourced from PubChem (CID 10261861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).