C7H9IN2OS — CID 102618696
5-iodo-3-(oxolan-2-ylmethyl)-1,2,4-thiadiazole (PubChem CID 102618696) has the molecular formula C7H9IN2OS and a molecular weight of 296.13 g/mol. Its IUPAC name is 5-iodo-3-(oxolan-2-ylmethyl)-1,2,4-thiadiazole.
| Compound Name | 5-iodo-3-(oxolan-2-ylmethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618696 |
| Molecular Formula | C7H9IN2OS |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 5-iodo-3-(oxolan-2-ylmethyl)-1,2,4-thiadiazole |
| SMILES | Ic1nc(CC2CCCO2)ns1 |
| InChI | InChI=1S/C7H9IN2OS/c8-7-9-6(10-12-7)4-5-2-1-3-11-5/h5H,1-4H2 |
| InChIKey | VRBPQPZDGGPPQF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|