C17H17ClFN — CID 102618859
2-(2-chloro-5-fluorophenyl)-1-(1-phenylcyclopropyl)ethanamine (PubChem CID 102618859) has the molecular formula C17H17ClFN and a molecular weight of 289.78 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-1-(1-phenylcyclopropyl)ethanamine.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-1-(1-phenylcyclopropyl)ethanamine |
|---|---|
| PubChem CID | 102618859 |
| Molecular Formula | C17H17ClFN |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-1-(1-phenylcyclopropyl)ethanamine |
| SMILES | NC(Cc1cc(F)ccc1Cl)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H17ClFN/c18-15-7-6-14(19)10-12(15)11-16(20)17(8-9-17)13-4-2-1-3-5-13/h1-7,10,16H,8-9,11,20H2 |
| InChIKey | BUYPOCFUBYHTSV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |